C14H30O6 — CID 3050085
1,1,1,2,2,2-hexaethoxyethane (PubChem CID 3050085) has the molecular formula C14H30O6 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1,1,1,2,2,2-hexaethoxyethane.
| Compound Name | 1,1,1,2,2,2-hexaethoxyethane |
|---|---|
| PubChem CID | 3050085 |
| Molecular Formula | C14H30O6 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 1,1,1,2,2,2-hexaethoxyethane |
| SMILES | CCOC(OCC)(OCC)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C14H30O6/c1-7-15-13(16-8-2,17-9-3)14(18-10-4,19-11-5)20-12-6/h7-12H2,1-6H3 |
| InChIKey | UVHGGILPAMVDJM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|