About [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride
[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride (PubChem CID 3050131) has the molecular formula C9H11ClN4S
and a molecular weight of 242.74 g/mol. Its IUPAC name is [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride.
Molecular Properties
| Compound Name | [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride |
| PubChem CID | 3050131 |
| Molecular Formula | C9H11ClN4S |
| Molecular Weight | 242.74 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride |
| SMILES | Cc1ccccc1-c1nnc(NN)s1.Cl |
| InChI | InChI=1S/C9H10N4S.ClH/c1-6-4-2-3-5-7(6)8-12-13-9(11-10)14-8;/h2-5H,10H2,1H3,(H,11,13);1H |
| InChIKey | SLFBMDDKFCRYAX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride?
The IUPAC name of [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride (CID 3050131) is [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride.
What is the SMILES notation for [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride?
The canonical SMILES for [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride is Cc1ccccc1-c1nnc(NN)s1.Cl.
What is the InChIKey of [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride?
The InChIKey is SLFBMDDKFCRYAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4S.ClH/c1-6-4-2-3-5-7(6)8-12-13-9(11-10)14-8;/h2-5H,10H2,1H3,(H,11,13);1H.
What are the key properties of [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride?
[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride has a molecular weight of 242.74 g/mol, XLogP of 2.22, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride is sourced from PubChem (CID 3050131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).