C10H23Cl3N6 — CID 3050288
N',N'-diethyl-N-(6-hydrazinylpyridazin-3-yl)ethane-1,2-diamine;trihydrochloride (PubChem CID 3050288) has the molecular formula C10H23Cl3N6 and a molecular weight of 333.70 g/mol. Its IUPAC name is N',N'-diethyl-N-(6-hydrazinylpyridazin-3-yl)ethane-1,2-diamine;trihydrochloride.
| Compound Name | N',N'-diethyl-N-(6-hydrazinylpyridazin-3-yl)ethane-1,2-diamine;trihydrochloride |
|---|---|
| PubChem CID | 3050288 |
| Molecular Formula | C10H23Cl3N6 |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N',N'-diethyl-N-(6-hydrazinylpyridazin-3-yl)ethane-1,2-diamine;trihydrochloride |
| SMILES | CCN(CC)CCNc1ccc(NN)nn1.Cl.Cl.Cl |
| InChI | InChI=1S/C10H20N6.3ClH/c1-3-16(4-2)8-7-12-9-5-6-10(13-11)15-14-9;;;/h5-6H,3-4,7-8,11H2,1-2H3,(H,12,14)(H,13,15);3*1H |
| InChIKey | UWOOOFSESJSTRD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|