C15H19ClF3NO2 — CID 3050312
3-[4-(trifluoromethyl)phenyl]-4,6,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazin-3-ol;hydrochloride (PubChem CID 3050312) has the molecular formula C15H19ClF3NO2 and a molecular weight of 337.77 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)phenyl]-4,6,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazin-3-ol;hydrochloride.
| Compound Name | 3-[4-(trifluoromethyl)phenyl]-4,6,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 3050312 |
| Molecular Formula | C15H19ClF3NO2 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-[4-(trifluoromethyl)phenyl]-4,6,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazin-3-ol;hydrochloride |
| SMILES | Cl.OC1(c2ccc(C(F)(F)F)cc2)CN2CCCCC2CO1 |
| InChI | InChI=1S/C15H18F3NO2.ClH/c16-15(17,18)12-6-4-11(5-7-12)14(20)10-19-8-2-1-3-13(19)9-21-14;/h4-7,13,20H,1-3,8-10H2;1H |
| InChIKey | ICGGIWFUMIFOEC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |