About 3-benzylpyrrolidine-2,5-dione
3-benzylpyrrolidine-2,5-dione (PubChem CID 3050332) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 3-benzylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-benzylpyrrolidine-2,5-dione |
| PubChem CID | 3050332 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 3-benzylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C11H11NO2/c13-10-7-9(11(14)12-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13,14) |
| InChIKey | OVJRWHNWCJFPBL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-benzylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylpyrrolidine-2,5-dione?
The IUPAC name of 3-benzylpyrrolidine-2,5-dione (CID 3050332) is 3-benzylpyrrolidine-2,5-dione.
What is the SMILES notation for 3-benzylpyrrolidine-2,5-dione?
The canonical SMILES for 3-benzylpyrrolidine-2,5-dione is O=C1CC(Cc2ccccc2)C(=O)N1.
What is the InChIKey of 3-benzylpyrrolidine-2,5-dione?
The InChIKey is OVJRWHNWCJFPBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c13-10-7-9(11(14)12-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13,14).
What are the key properties of 3-benzylpyrrolidine-2,5-dione?
3-benzylpyrrolidine-2,5-dione has a molecular weight of 189.21 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylpyrrolidine-2,5-dione is sourced from PubChem (CID 3050332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).