C10H17BrClN — CID 3050496
4-(2-bromoethyl)-7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-4-ium chloride (PubChem CID 3050496) has the molecular formula C10H17BrClN and a molecular weight of 266.61 g/mol. Its IUPAC name is 4-(2-bromoethyl)-7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-4-ium chloride.
| Compound Name | 4-(2-bromoethyl)-7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-4-ium chloride |
|---|---|
| PubChem CID | 3050496 |
| Molecular Formula | C10H17BrClN |
| Molecular Weight | 266.61 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 4-(2-bromoethyl)-7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-4-ium chloride |
| SMILES | C=C1CC[N+]2(CCBr)CCCC12.[Cl-] |
| InChI | InChI=1S/C10H17BrN.ClH/c1-9-4-7-12(8-5-11)6-2-3-10(9)12;/h10H,1-8H2;1H/q+1;/p-1 |
| InChIKey | QCXIQKJSPMXRTP-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.61 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|