C11H10ClN3O — CID 3050524
6-chloro-2-methyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-10-one (PubChem CID 3050524) has the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. Its IUPAC name is 6-chloro-2-methyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-10-one.
| Compound Name | 6-chloro-2-methyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-10-one |
|---|---|
| PubChem CID | 3050524 |
| Molecular Formula | C11H10ClN3O |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 6-chloro-2-methyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-10-one |
| SMILES | Cc1nc2cc(Cl)cc3c2n1CCC(=O)N3 |
| InChI | InChI=1S/C11H10ClN3O/c1-6-13-8-4-7(12)5-9-11(8)15(6)3-2-10(16)14-9/h4-5H,2-3H2,1H3,(H,14,16) |
| InChIKey | BSIMLQQHKHRWOM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |