About 6-morpholin-4-yl-4,4-diphenylhexan-3-imine
6-morpholin-4-yl-4,4-diphenylhexan-3-imine (PubChem CID 3050616) has the molecular formula C22H28N2O
and a molecular weight of 336.48 g/mol. Its IUPAC name is 6-morpholin-4-yl-4,4-diphenylhexan-3-imine.
Molecular Properties
| Compound Name | 6-morpholin-4-yl-4,4-diphenylhexan-3-imine |
| PubChem CID | 3050616 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 6-morpholin-4-yl-4,4-diphenylhexan-3-imine |
| SMILES | [H]/N=C(\CC)C(CCN1CCOCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O/c1-2-21(23)22(19-9-5-3-6-10-19,20-11-7-4-8-12-20)13-14-24-15-17-25-18-16-24/h3-12,23H,2,13-18H2,1H3/b23-21+ |
| InChIKey | UXHYBOXJCZJLRG-XTQSDGFTSA-N |
| XLogP | 4.12 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-morpholin-4-yl-4,4-diphenylhexan-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-morpholin-4-yl-4,4-diphenylhexan-3-imine?
The IUPAC name of 6-morpholin-4-yl-4,4-diphenylhexan-3-imine (CID 3050616) is 6-morpholin-4-yl-4,4-diphenylhexan-3-imine.
What is the SMILES notation for 6-morpholin-4-yl-4,4-diphenylhexan-3-imine?
The canonical SMILES for 6-morpholin-4-yl-4,4-diphenylhexan-3-imine is [H]/N=C(\CC)C(CCN1CCOCC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 6-morpholin-4-yl-4,4-diphenylhexan-3-imine?
The InChIKey is UXHYBOXJCZJLRG-XTQSDGFTSA-N. The full InChI is InChI=1S/C22H28N2O/c1-2-21(23)22(19-9-5-3-6-10-19,20-11-7-4-8-12-20)13-14-24-15-17-25-18-16-24/h3-12,23H,2,13-18H2,1H3/b23-21+.
What are the key properties of 6-morpholin-4-yl-4,4-diphenylhexan-3-imine?
6-morpholin-4-yl-4,4-diphenylhexan-3-imine has a molecular weight of 336.48 g/mol, XLogP of 4.12, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-morpholin-4-yl-4,4-diphenylhexan-3-imine is sourced from PubChem (CID 3050616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).