About 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine
1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine (PubChem CID 3050782) has the molecular formula C14H20N4
and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine.
Molecular Properties
| Compound Name | 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine |
| PubChem CID | 3050782 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine |
| SMILES | CC(/N=C(\NC#N)Nc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C14H20N4/c1-11(14(2,3)4)17-13(16-10-15)18-12-8-6-5-7-9-12/h5-9,11H,1-4H3,(H2,16,17,18) |
| InChIKey | BNIZYODSEJZOIY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine?
The IUPAC name of 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine (CID 3050782) is 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine.
What is the SMILES notation for 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine?
The canonical SMILES for 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine is CC(/N=C(\NC#N)Nc1ccccc1)C(C)(C)C.
What is the InChIKey of 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine?
The InChIKey is BNIZYODSEJZOIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4/c1-11(14(2,3)4)17-13(16-10-15)18-12-8-6-5-7-9-12/h5-9,11H,1-4H3,(H2,16,17,18).
What are the key properties of 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine?
1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine has a molecular weight of 244.34 g/mol, XLogP of 2.96, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-2-(3,3-dimethylbutan-2-yl)-3-phenylguanidine is sourced from PubChem (CID 3050782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).