About 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride
2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride (PubChem CID 3050833) has the molecular formula C15H18ClNO2S
and a molecular weight of 311.83 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride |
| PubChem CID | 3050833 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)CCc2ccccn2)c(C)c1.Cl |
| InChI | InChI=1S/C15H17NO2S.ClH/c1-12-6-7-15(13(2)11-12)19(17,18)10-8-14-5-3-4-9-16-14;/h3-7,9,11H,8,10H2,1-2H3;1H |
| InChIKey | OLZXFUDWQATLFM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride?
The IUPAC name of 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride (CID 3050833) is 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride.
What is the SMILES notation for 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride?
The canonical SMILES for 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride is Cc1ccc(S(=O)(=O)CCc2ccccn2)c(C)c1.Cl.
What is the InChIKey of 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride?
The InChIKey is OLZXFUDWQATLFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2S.ClH/c1-12-6-7-15(13(2)11-12)19(17,18)10-8-14-5-3-4-9-16-14;/h3-7,9,11H,8,10H2,1-2H3;1H.
What are the key properties of 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride?
2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride has a molecular weight of 311.83 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dimethylphenyl)sulfonylethyl]pyridine;hydrochloride is sourced from PubChem (CID 3050833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).