About 2-(3-fluorophenyl)-1,3-thiazolidine
2-(3-fluorophenyl)-1,3-thiazolidine (PubChem CID 3050853) has the molecular formula C9H10FNS
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(3-fluorophenyl)-1,3-thiazolidine |
| PubChem CID | 3050853 |
| Molecular Formula | C9H10FNS |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 2-(3-fluorophenyl)-1,3-thiazolidine |
| SMILES | Fc1cccc(C2NCCS2)c1 |
| InChI | InChI=1S/C9H10FNS/c10-8-3-1-2-7(6-8)9-11-4-5-12-9/h1-3,6,9,11H,4-5H2 |
| InChIKey | ANEUIKFKIJGTQX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-fluorophenyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorophenyl)-1,3-thiazolidine?
The IUPAC name of 2-(3-fluorophenyl)-1,3-thiazolidine (CID 3050853) is 2-(3-fluorophenyl)-1,3-thiazolidine.
What is the SMILES notation for 2-(3-fluorophenyl)-1,3-thiazolidine?
The canonical SMILES for 2-(3-fluorophenyl)-1,3-thiazolidine is Fc1cccc(C2NCCS2)c1.
What is the InChIKey of 2-(3-fluorophenyl)-1,3-thiazolidine?
The InChIKey is ANEUIKFKIJGTQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNS/c10-8-3-1-2-7(6-8)9-11-4-5-12-9/h1-3,6,9,11H,4-5H2.
What are the key properties of 2-(3-fluorophenyl)-1,3-thiazolidine?
2-(3-fluorophenyl)-1,3-thiazolidine has a molecular weight of 183.25 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)-1,3-thiazolidine is sourced from PubChem (CID 3050853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).