About 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride
1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride (PubChem CID 3050912) has the molecular formula C22H27ClN2O
and a molecular weight of 370.92 g/mol. Its IUPAC name is 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride |
| PubChem CID | 3050912 |
| Molecular Formula | C22H27ClN2O |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride |
| SMILES | CCC(=O)N1C2CCC1CN(C(c1ccccc1)c1ccccc1)C2.Cl |
| InChI | InChI=1S/C22H26N2O.ClH/c1-2-21(25)24-19-13-14-20(24)16-23(15-19)22(17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-12,19-20,22H,2,13-16H2,1H3;1H |
| InChIKey | QASMNFXUBVOVRF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride?
The IUPAC name of 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride (CID 3050912) is 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride.
What is the SMILES notation for 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride?
The canonical SMILES for 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride is CCC(=O)N1C2CCC1CN(C(c1ccccc1)c1ccccc1)C2.Cl.
What is the InChIKey of 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride?
The InChIKey is QASMNFXUBVOVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O.ClH/c1-2-21(25)24-19-13-14-20(24)16-23(15-19)22(17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-12,19-20,22H,2,13-16H2,1H3;1H.
What are the key properties of 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride?
1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride has a molecular weight of 370.92 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one;hydrochloride is sourced from PubChem (CID 3050912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).