About 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile
2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile (PubChem CID 3050970) has the molecular formula C14H14F3N3
and a molecular weight of 281.28 g/mol. Its IUPAC name is 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile |
| PubChem CID | 3050970 |
| Molecular Formula | C14H14F3N3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile |
| SMILES | CCCN(CCC)c1c(F)c(C#N)c(F)c(F)c1C#N |
| InChI | InChI=1S/C14H14F3N3/c1-3-5-20(6-4-2)14-10(8-19)12(16)11(15)9(7-18)13(14)17/h3-6H2,1-2H3 |
| InChIKey | MOQOSQYVIZYXMK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile?
The IUPAC name of 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile (CID 3050970) is 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile.
What is the SMILES notation for 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile?
The canonical SMILES for 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile is CCCN(CCC)c1c(F)c(C#N)c(F)c(F)c1C#N.
What is the InChIKey of 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile?
The InChIKey is MOQOSQYVIZYXMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N3/c1-3-5-20(6-4-2)14-10(8-19)12(16)11(15)9(7-18)13(14)17/h3-6H2,1-2H3.
What are the key properties of 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile?
2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile has a molecular weight of 281.28 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dipropylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile is sourced from PubChem (CID 3050970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).