C22H28N2O4 — CID 3051001
N,N'-bis[1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]ethane-1,2-diamine (PubChem CID 3051001) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N,N'-bis[1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 3051001 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N,N'-bis[1-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]ethane-1,2-diamine |
| SMILES | CC(NCCNC(C)C1COc2ccccc2O1)C1COc2ccccc2O1 |
| InChI | InChI=1S/C22H28N2O4/c1-15(21-13-25-17-7-3-5-9-19(17)27-21)23-11-12-24-16(2)22-14-26-18-8-4-6-10-20(18)28-22/h3-10,15-16,21-24H,11-14H2,1-2H3 |
| InChIKey | KJYJRKOAKJOFBK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|