About 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride
2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride (PubChem CID 3051020) has the molecular formula C17H34ClNO2
and a molecular weight of 319.92 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride |
| PubChem CID | 3051020 |
| Molecular Formula | C17H34ClNO2 |
| Molecular Weight | 319.92 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride |
| SMILES | CCCCC(C(=O)OCCN(CC)CC)C1CCCC1.Cl |
| InChI | InChI=1S/C17H33NO2.ClH/c1-4-7-12-16(15-10-8-9-11-15)17(19)20-14-13-18(5-2)6-3;/h15-16H,4-14H2,1-3H3;1H |
| InChIKey | ZQXIFCXDUMTEIK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.92 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride (CID 3051020) is 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride is CCCCC(C(=O)OCCN(CC)CC)C1CCCC1.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride?
The InChIKey is ZQXIFCXDUMTEIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO2.ClH/c1-4-7-12-16(15-10-8-9-11-15)17(19)20-14-13-18(5-2)6-3;/h15-16H,4-14H2,1-3H3;1H.
What are the key properties of 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride?
2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride has a molecular weight of 319.92 g/mol, XLogP of 4.29, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-cyclopentylhexanoate;hydrochloride is sourced from PubChem (CID 3051020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).