C13H18ClNO2 — CID 3051059
(3S,4S,6S)-6-(2-chlorophenyl)-1,3-dimethylpiperidine-3,4-diol (PubChem CID 3051059) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is (3S,4S,6S)-6-(2-chlorophenyl)-1,3-dimethylpiperidine-3,4-diol.
| Compound Name | (3S,4S,6S)-6-(2-chlorophenyl)-1,3-dimethylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 3051059 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (3S,4S,6S)-6-(2-chlorophenyl)-1,3-dimethylpiperidine-3,4-diol |
| SMILES | CN1C[C@](C)(O)[C@@H](O)C[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C13H18ClNO2/c1-13(17)8-15(2)11(7-12(13)16)9-5-3-4-6-10(9)14/h3-6,11-12,16-17H,7-8H2,1-2H3/t11-,12-,13-/m0/s1 |
| InChIKey | FGILBIAQXWCXFC-AVGNSLFASA-N |
| XLogP | 1.83 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |