C19H24ClNO2 — CID 3051074
(3S,4S,6S)-1-benzyl-3-methyl-6-phenylpiperidine-3,4-diol;hydrochloride (PubChem CID 3051074) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is (3S,4S,6S)-1-benzyl-3-methyl-6-phenylpiperidine-3,4-diol;hydrochloride.
| Compound Name | (3S,4S,6S)-1-benzyl-3-methyl-6-phenylpiperidine-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 3051074 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (3S,4S,6S)-1-benzyl-3-methyl-6-phenylpiperidine-3,4-diol;hydrochloride |
| SMILES | C[C@]1(O)CN(Cc2ccccc2)[C@H](c2ccccc2)C[C@@H]1O.Cl |
| InChI | InChI=1S/C19H23NO2.ClH/c1-19(22)14-20(13-15-8-4-2-5-9-15)17(12-18(19)21)16-10-6-3-7-11-16;/h2-11,17-18,21-22H,12-14H2,1H3;1H/t17-,18-,19-;/m0./s1 |
| InChIKey | HKSZUHZGCZFEFN-YOTVLOEGSA-N |
| XLogP | 3.17 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |