C13H20ClNO2 — CID 3051108
(3S,4S,6S)-1,3-dimethyl-6-phenylpiperidine-3,4-diol;hydrochloride (PubChem CID 3051108) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is (3S,4S,6S)-1,3-dimethyl-6-phenylpiperidine-3,4-diol;hydrochloride.
| Compound Name | (3S,4S,6S)-1,3-dimethyl-6-phenylpiperidine-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 3051108 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (3S,4S,6S)-1,3-dimethyl-6-phenylpiperidine-3,4-diol;hydrochloride |
| SMILES | CN1C[C@](C)(O)[C@@H](O)C[C@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C13H19NO2.ClH/c1-13(16)9-14(2)11(8-12(13)15)10-6-4-3-5-7-10;/h3-7,11-12,15-16H,8-9H2,1-2H3;1H/t11-,12-,13-;/m0./s1 |
| InChIKey | QWQHEUUYPURYGS-QKWXXBCPSA-N |
| XLogP | 1.60 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |