About N-methylhex-5-en-2-amine
N-methylhex-5-en-2-amine (PubChem CID 3051131) has the molecular formula C7H15N
and a molecular weight of 113.20 g/mol. Its IUPAC name is N-methylhex-5-en-2-amine.
Molecular Properties
| Compound Name | N-methylhex-5-en-2-amine |
| PubChem CID | 3051131 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | N-methylhex-5-en-2-amine |
| SMILES | C=CCCC(C)NC |
| InChI | InChI=1S/C7H15N/c1-4-5-6-7(2)8-3/h4,7-8H,1,5-6H2,2-3H3 |
| InChIKey | VTHXHYHQTDXWRR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methylhex-5-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylhex-5-en-2-amine?
The IUPAC name of N-methylhex-5-en-2-amine (CID 3051131) is N-methylhex-5-en-2-amine.
What is the SMILES notation for N-methylhex-5-en-2-amine?
The canonical SMILES for N-methylhex-5-en-2-amine is C=CCCC(C)NC.
What is the InChIKey of N-methylhex-5-en-2-amine?
The InChIKey is VTHXHYHQTDXWRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N/c1-4-5-6-7(2)8-3/h4,7-8H,1,5-6H2,2-3H3.
What are the key properties of N-methylhex-5-en-2-amine?
N-methylhex-5-en-2-amine has a molecular weight of 113.20 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylhex-5-en-2-amine is sourced from PubChem (CID 3051131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).