About 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate
4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate (PubChem CID 3051145) has the molecular formula C30H37NO3
and a molecular weight of 459.63 g/mol. Its IUPAC name is 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate.
Molecular Properties
| Compound Name | 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate |
| PubChem CID | 3051145 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate |
| SMILES | CCN(CCCCOC(=O)C(c1ccccc1)c1ccccc1)C(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H37NO3/c1-4-31(24(2)23-25-17-19-28(33-3)20-18-25)21-11-12-22-34-30(32)29(26-13-7-5-8-14-26)27-15-9-6-10-16-27/h5-10,13-20,24,29H,4,11-12,21-23H2,1-3H3 |
| InChIKey | QRWXIZGPDSZWBV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate?
The IUPAC name of 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate (CID 3051145) is 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate.
What is the SMILES notation for 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate?
The canonical SMILES for 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate is CCN(CCCCOC(=O)C(c1ccccc1)c1ccccc1)C(C)Cc1ccc(OC)cc1.
What is the InChIKey of 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate?
The InChIKey is QRWXIZGPDSZWBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H37NO3/c1-4-31(24(2)23-25-17-19-28(33-3)20-18-25)21-11-12-22-34-30(32)29(26-13-7-5-8-14-26)27-15-9-6-10-16-27/h5-10,13-20,24,29H,4,11-12,21-23H2,1-3H3.
What are the key properties of 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate?
4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate has a molecular weight of 459.63 g/mol, XLogP of 6.10, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 2,2-diphenylacetate is sourced from PubChem (CID 3051145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).