C20H24N2O2S — CID 3051226
1-methyl-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylsulfonyl)piperazine (PubChem CID 3051226) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-methyl-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylsulfonyl)piperazine.
| Compound Name | 1-methyl-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylsulfonyl)piperazine |
|---|---|
| PubChem CID | 3051226 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-methyl-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylsulfonyl)piperazine |
| SMILES | CN1CCN(S(=O)(=O)C2c3ccccc3CCc3ccccc32)CC1 |
| InChI | InChI=1S/C20H24N2O2S/c1-21-12-14-22(15-13-21)25(23,24)20-18-8-4-2-6-16(18)10-11-17-7-3-5-9-19(17)20/h2-9,20H,10-15H2,1H3 |
| InChIKey | ABJBXGUBXHNMKN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |