C20H25NO — CID 3051292
2-[bis(prop-2-enyl)amino]-1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)ethanone (PubChem CID 3051292) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)amino]-1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)ethanone.
| Compound Name | 2-[bis(prop-2-enyl)amino]-1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)ethanone |
|---|---|
| PubChem CID | 3051292 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[bis(prop-2-enyl)amino]-1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)ethanone |
| SMILES | C=CCN(CC=C)CC(=O)c1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C20H25NO/c1-3-11-21(12-4-2)14-19(22)20-17-9-5-7-15(17)13-16-8-6-10-18(16)20/h3-4,13H,1-2,5-12,14H2 |
| InChIKey | YXSYSFOLHZNTJQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|