C28H37NO6 — CID 3051365
N,N-dibenzyl-2-[[(5R,6S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethanamine (PubChem CID 3051365) has the molecular formula C28H37NO6 and a molecular weight of 483.61 g/mol. Its IUPAC name is N,N-dibenzyl-2-[[(5R,6S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethanamine.
| Compound Name | N,N-dibenzyl-2-[[(5R,6S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethanamine |
|---|---|
| PubChem CID | 3051365 |
| Molecular Formula | C28H37NO6 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | N,N-dibenzyl-2-[[(5R,6S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethanamine |
| SMILES | CC1(C)OC2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OCCN(Cc3ccccc3)Cc3ccccc3)C2O1 |
| InChI | InChI=1S/C28H37NO6/c1-27(2)31-19-22(33-27)23-24(25-26(32-23)35-28(3,4)34-25)30-16-15-29(17-20-11-7-5-8-12-20)18-21-13-9-6-10-14-21/h5-14,22-26H,15-19H2,1-4H3/t22-,23-,24+,25?,26?/m1/s1 |
| InChIKey | CGNOTYOIVDTGPX-SXKBUZGKSA-N |
| XLogP | 4.10 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |