About [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate
[2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate (PubChem CID 3051497) has the molecular formula C19H23NO2
and a molecular weight of 297.40 g/mol. Its IUPAC name is [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate.
Molecular Properties
| Compound Name | [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate |
| PubChem CID | 3051497 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate |
| SMILES | CN(C)CC(OC(=O)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-20(2)15-18(17-11-7-4-8-12-17)22-19(21)14-13-16-9-5-3-6-10-16/h3-12,18H,13-15H2,1-2H3 |
| InChIKey | LQTRKHHHCNJRLT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate?
The IUPAC name of [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate (CID 3051497) is [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate.
What is the SMILES notation for [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate?
The canonical SMILES for [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate is CN(C)CC(OC(=O)CCc1ccccc1)c1ccccc1.
What is the InChIKey of [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate?
The InChIKey is LQTRKHHHCNJRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO2/c1-20(2)15-18(17-11-7-4-8-12-17)22-19(21)14-13-16-9-5-3-6-10-16/h3-12,18H,13-15H2,1-2H3.
What are the key properties of [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate?
[2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate has a molecular weight of 297.40 g/mol, XLogP of 3.47, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethylamino)-1-phenylethyl] 3-phenylpropanoate is sourced from PubChem (CID 3051497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).