About (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide
(1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide (PubChem CID 3051581) has the molecular formula C10H15BrN2O2
and a molecular weight of 275.15 g/mol. Its IUPAC name is (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide.
Molecular Properties
| Compound Name | (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide |
| PubChem CID | 3051581 |
| Molecular Formula | C10H15BrN2O2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide |
| SMILES | Cc1ccc(OC(=O)N(C)C)c[n+]1C.[Br-] |
| InChI | InChI=1S/C10H15N2O2.BrH/c1-8-5-6-9(7-12(8)4)14-10(13)11(2)3;/h5-7H,1-4H3;1H/q+1;/p-1 |
| InChIKey | SIKCQDLRACDUGT-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide?
The IUPAC name of (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide (CID 3051581) is (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide.
What is the SMILES notation for (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide?
The canonical SMILES for (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide is Cc1ccc(OC(=O)N(C)C)c[n+]1C.[Br-].
What is the InChIKey of (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide?
The InChIKey is SIKCQDLRACDUGT-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H15N2O2.BrH/c1-8-5-6-9(7-12(8)4)14-10(13)11(2)3;/h5-7H,1-4H3;1H/q+1;/p-1.
What are the key properties of (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide?
(1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide has a molecular weight of 275.15 g/mol, XLogP of -2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6-dimethylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide is sourced from PubChem (CID 3051581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).