C17H23IN2S — CID 30516
N,N-dimethyl-4-(3-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium-2-yl)aniline iodide (PubChem CID 30516) has the molecular formula C17H23IN2S and a molecular weight of 414.36 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium-2-yl)aniline iodide.
| Compound Name | N,N-dimethyl-4-(3-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium-2-yl)aniline iodide |
|---|---|
| PubChem CID | 30516 |
| Molecular Formula | C17H23IN2S |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N,N-dimethyl-4-(3-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium-2-yl)aniline iodide |
| SMILES | CN(C)c1ccc(-c2sc3c([n+]2C)CCCCC3)cc1.[I-] |
| InChI | InChI=1S/C17H23N2S.HI/c1-18(2)14-11-9-13(10-12-14)17-19(3)15-7-5-4-6-8-16(15)20-17;/h9-12H,4-8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UIZJMJHHYOOWAE-UHFFFAOYSA-M |
| XLogP | 0.58 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|