About N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine
N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine (PubChem CID 3051649) has the molecular formula C22H31ClN2
and a molecular weight of 358.96 g/mol. Its IUPAC name is N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine |
| PubChem CID | 3051649 |
| Molecular Formula | C22H31ClN2 |
| Molecular Weight | 358.96 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCN(c1ccc(C(C)(C)C)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H31ClN2/c1-6-24(7-2)15-16-25(21-10-8-9-19(23)17-21)20-13-11-18(12-14-20)22(3,4)5/h8-14,17H,6-7,15-16H2,1-5H3 |
| InChIKey | MMORYAOUSLOLST-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.96 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine?
The IUPAC name of N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine (CID 3051649) is N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine.
What is the SMILES notation for N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine?
The canonical SMILES for N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine is CCN(CC)CCN(c1ccc(C(C)(C)C)cc1)c1cccc(Cl)c1.
What is the InChIKey of N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine?
The InChIKey is MMORYAOUSLOLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31ClN2/c1-6-24(7-2)15-16-25(21-10-8-9-19(23)17-21)20-13-11-18(12-14-20)22(3,4)5/h8-14,17H,6-7,15-16H2,1-5H3.
What are the key properties of N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine?
N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine has a molecular weight of 358.96 g/mol, XLogP of 6.12, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-tert-butylphenyl)-N'-(3-chlorophenyl)-N,N-diethylethane-1,2-diamine is sourced from PubChem (CID 3051649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).