C40H56N6O8 — CID 3051731
bis(9-[2-(diethylamino)ethyl]-2,3-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-one);(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 3051731) has the molecular formula C40H56N6O8 and a molecular weight of 748.92 g/mol. Its IUPAC name is bis(9-[2-(diethylamino)ethyl]-2,3-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-one);(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | bis(9-[2-(diethylamino)ethyl]-2,3-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-one);(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 3051731 |
| Molecular Formula | C40H56N6O8 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.42 |
| IUPAC Name | bis(9-[2-(diethylamino)ethyl]-2,3-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-one);(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | CCN(CC)CCN1C(=O)Cn2c(C)c(C)c3cccc1c32.CCN(CC)CCN1C(=O)Cn2c(C)c(C)c3cccc1c32.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/2C18H25N3O.C4H6O6/c2*1-5-19(6-2)10-11-20-16-9-7-8-15-13(3)14(4)21(18(15)16)12-17(20)22;5-1(3(7)8)2(6)4(9)10/h2*7-9H,5-6,10-12H2,1-4H3;1-2,5-6H,(H,7,8)(H,9,10)/t;;1-,2-/m..1/s1 |
| InChIKey | ZAMHSVVJRKRBGO-CEAXSRTFSA-N |
| XLogP | 3.77 |
| TPSA | 172.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|