C50H60N6O8 — CID 3051810
bis(9-[2-(diethylamino)ethyl]-2-methyl-3-phenyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-one);(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 3051810) has the molecular formula C50H60N6O8 and a molecular weight of 873.06 g/mol. Its IUPAC name is bis(9-[2-(diethylamino)ethyl]-2-methyl-3-phenyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-one);(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | bis(9-[2-(diethylamino)ethyl]-2-methyl-3-phenyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-one);(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 3051810 |
| Molecular Formula | C50H60N6O8 |
| Molecular Weight | 873.06 g/mol |
| Exact Mass | 872.45 |
| IUPAC Name | bis(9-[2-(diethylamino)ethyl]-2-methyl-3-phenyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-one);(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | CCN(CC)CCN1C(=O)Cn2c(C)c(-c3ccccc3)c3cccc1c32.CCN(CC)CCN1C(=O)Cn2c(C)c(-c3ccccc3)c3cccc1c32.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/2C23H27N3O.C4H6O6/c2*1-4-24(5-2)14-15-25-20-13-9-12-19-22(18-10-7-6-8-11-18)17(3)26(23(19)20)16-21(25)27;5-1(3(7)8)2(6)4(9)10/h2*6-13H,4-5,14-16H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/t;;1-,2-/m..1/s1 |
| InChIKey | IHUZQGIQZATSRT-CEAXSRTFSA-N |
| XLogP | 6.49 |
| TPSA | 172.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.06 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |