About (4-iodophenyl)methyl N-octylcarbamate
(4-iodophenyl)methyl N-octylcarbamate (PubChem CID 3051860) has the molecular formula C16H24INO2
and a molecular weight of 389.28 g/mol. Its IUPAC name is (4-iodophenyl)methyl N-octylcarbamate.
Molecular Properties
| Compound Name | (4-iodophenyl)methyl N-octylcarbamate |
| PubChem CID | 3051860 |
| Molecular Formula | C16H24INO2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (4-iodophenyl)methyl N-octylcarbamate |
| SMILES | CCCCCCCCNC(=O)OCc1ccc(I)cc1 |
| InChI | InChI=1S/C16H24INO2/c1-2-3-4-5-6-7-12-18-16(19)20-13-14-8-10-15(17)11-9-14/h8-11H,2-7,12-13H2,1H3,(H,18,19) |
| InChIKey | JJPKBELLAUEUPK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-iodophenyl)methyl N-octylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodophenyl)methyl N-octylcarbamate?
The IUPAC name of (4-iodophenyl)methyl N-octylcarbamate (CID 3051860) is (4-iodophenyl)methyl N-octylcarbamate.
What is the SMILES notation for (4-iodophenyl)methyl N-octylcarbamate?
The canonical SMILES for (4-iodophenyl)methyl N-octylcarbamate is CCCCCCCCNC(=O)OCc1ccc(I)cc1.
What is the InChIKey of (4-iodophenyl)methyl N-octylcarbamate?
The InChIKey is JJPKBELLAUEUPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24INO2/c1-2-3-4-5-6-7-12-18-16(19)20-13-14-8-10-15(17)11-9-14/h8-11H,2-7,12-13H2,1H3,(H,18,19).
What are the key properties of (4-iodophenyl)methyl N-octylcarbamate?
(4-iodophenyl)methyl N-octylcarbamate has a molecular weight of 389.28 g/mol, XLogP of 4.88, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodophenyl)methyl N-octylcarbamate is sourced from PubChem (CID 3051860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).