About (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride
(3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride (PubChem CID 3051890) has the molecular formula C15H23ClN2O5
and a molecular weight of 346.81 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride |
| PubChem CID | 3051890 |
| Molecular Formula | C15H23ClN2O5 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride |
| SMILES | COc1cc(OC(=O)N2CCN(C)CC2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C15H22N2O5.ClH/c1-16-5-7-17(8-6-16)15(18)22-11-9-12(19-2)14(21-4)13(10-11)20-3;/h9-10H,5-8H2,1-4H3;1H |
| InChIKey | DHDITJUBLNTMJJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride?
The IUPAC name of (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride (CID 3051890) is (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride.
What is the SMILES notation for (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride?
The canonical SMILES for (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride is COc1cc(OC(=O)N2CCN(C)CC2)cc(OC)c1OC.Cl.
What is the InChIKey of (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride?
The InChIKey is DHDITJUBLNTMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O5.ClH/c1-16-5-7-17(8-6-16)15(18)22-11-9-12(19-2)14(21-4)13(10-11)20-3;/h9-10H,5-8H2,1-4H3;1H.
What are the key properties of (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride?
(3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride has a molecular weight of 346.81 g/mol, XLogP of 1.88, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-trimethoxyphenyl) 4-methylpiperazine-1-carboxylate;hydrochloride is sourced from PubChem (CID 3051890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).