C19H23ClN2O5 — CID 3051911
1-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-(3,4,5-trimethoxyanilino)ethanone;hydrochloride (PubChem CID 3051911) has the molecular formula C19H23ClN2O5 and a molecular weight of 394.86 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-(3,4,5-trimethoxyanilino)ethanone;hydrochloride.
| Compound Name | 1-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-(3,4,5-trimethoxyanilino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 3051911 |
| Molecular Formula | C19H23ClN2O5 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-(3,4,5-trimethoxyanilino)ethanone;hydrochloride |
| SMILES | COc1cc(NCC(=O)N2CCOc3ccccc32)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C19H22N2O5.ClH/c1-23-16-10-13(11-17(24-2)19(16)25-3)20-12-18(22)21-8-9-26-15-7-5-4-6-14(15)21;/h4-7,10-11,20H,8-9,12H2,1-3H3;1H |
| InChIKey | YIHDUSNEJNQEED-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|