About 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol
4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol (PubChem CID 3051928) has the molecular formula C23H31N3O3
and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol.
Molecular Properties
| Compound Name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol |
| PubChem CID | 3051928 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol |
| SMILES | CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.CN(C)CCO |
| InChI | InChI=1S/C19H20N2O2.C4H11NO/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;1-5(2)3-4-6/h4-13,17H,2-3,14H2,1H3;6H,3-4H2,1-2H3 |
| InChIKey | BRBNJZRSGQDYQW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol?
The IUPAC name of 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol (CID 3051928) is 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol.
What is the SMILES notation for 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol?
The canonical SMILES for 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol is CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.CN(C)CCO.
What is the InChIKey of 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol?
The InChIKey is BRBNJZRSGQDYQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2.C4H11NO/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;1-5(2)3-4-6/h4-13,17H,2-3,14H2,1H3;6H,3-4H2,1-2H3.
What are the key properties of 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol?
4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol has a molecular weight of 397.52 g/mol, XLogP of 3.33, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(dimethylamino)ethanol is sourced from PubChem (CID 3051928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).