C26H32Cl2N2O2 — CID 3052104
3-[(4,6-dibenzyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N,N-dimethylpropan-1-amine;dihydrochloride (PubChem CID 3052104) has the molecular formula C26H32Cl2N2O2 and a molecular weight of 475.46 g/mol. Its IUPAC name is 3-[(4,6-dibenzyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N,N-dimethylpropan-1-amine;dihydrochloride.
| Compound Name | 3-[(4,6-dibenzyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N,N-dimethylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 3052104 |
| Molecular Formula | C26H32Cl2N2O2 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 3-[(4,6-dibenzyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N,N-dimethylpropan-1-amine;dihydrochloride |
| SMILES | CN(C)CCCOc1c(Cc2ccccc2)nc(Cc2ccccc2)c2c1COC2.Cl.Cl |
| InChI | InChI=1S/C26H30N2O2.2ClH/c1-28(2)14-9-15-30-26-23-19-29-18-22(23)24(16-20-10-5-3-6-11-20)27-25(26)17-21-12-7-4-8-13-21;;/h3-8,10-13H,9,14-19H2,1-2H3;2*1H |
| InChIKey | QVOCIOPWULAKRV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|