C23H34Cl2N2O2 — CID 3052112
5-[(4-benzyl-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N-propan-2-ylpentan-1-amine;dihydrochloride (PubChem CID 3052112) has the molecular formula C23H34Cl2N2O2 and a molecular weight of 441.44 g/mol. Its IUPAC name is 5-[(4-benzyl-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N-propan-2-ylpentan-1-amine;dihydrochloride.
| Compound Name | 5-[(4-benzyl-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N-propan-2-ylpentan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 3052112 |
| Molecular Formula | C23H34Cl2N2O2 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 5-[(4-benzyl-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N-propan-2-ylpentan-1-amine;dihydrochloride |
| SMILES | Cc1nc(Cc2ccccc2)c2c(c1OCCCCCNC(C)C)COC2.Cl.Cl |
| InChI | InChI=1S/C23H32N2O2.2ClH/c1-17(2)24-12-8-5-9-13-27-23-18(3)25-22(20-15-26-16-21(20)23)14-19-10-6-4-7-11-19;;/h4,6-7,10-11,17,24H,5,8-9,12-16H2,1-3H3;2*1H |
| InChIKey | QCAODWNBXFEJTG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|