C21H30Cl2N2O2 — CID 3052118
4-[(4-benzyl-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N-ethylbutan-1-amine;dihydrochloride (PubChem CID 3052118) has the molecular formula C21H30Cl2N2O2 and a molecular weight of 413.39 g/mol. Its IUPAC name is 4-[(4-benzyl-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N-ethylbutan-1-amine;dihydrochloride.
| Compound Name | 4-[(4-benzyl-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N-ethylbutan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 3052118 |
| Molecular Formula | C21H30Cl2N2O2 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-[(4-benzyl-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl)oxy]-N-ethylbutan-1-amine;dihydrochloride |
| SMILES | CCNCCCCOc1c(C)nc(Cc2ccccc2)c2c1COC2.Cl.Cl |
| InChI | InChI=1S/C21H28N2O2.2ClH/c1-3-22-11-7-8-12-25-21-16(2)23-20(18-14-24-15-19(18)21)13-17-9-5-4-6-10-17;;/h4-6,9-10,22H,3,7-8,11-15H2,1-2H3;2*1H |
| InChIKey | ORKWPDFHYUMUDQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|