C16H22FNO10 — CID 3052159
[(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(2-fluoroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 3052159) has the molecular formula C16H22FNO10 and a molecular weight of 407.35 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(2-fluoroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(2-fluoroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3052159 |
| Molecular Formula | C16H22FNO10 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(2-fluoroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](NC(=O)CF)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H22FNO10/c1-7(19)24-6-11-14(25-8(2)20)15(26-9(3)21)13(18-12(23)5-17)16(28-11)27-10(4)22/h11,13-16H,5-6H2,1-4H3,(H,18,23)/t11-,13-,14+,15-,16-/m1/s1 |
| InChIKey | NAHRHHCRHQYYSV-YMILTQATSA-N |
| XLogP | -0.84 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|