About 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride
1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride (PubChem CID 3052264) has the molecular formula C9H11Cl3N4O
and a molecular weight of 297.57 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride.
Molecular Properties
| Compound Name | 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride |
| PubChem CID | 3052264 |
| Molecular Formula | C9H11Cl3N4O |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride |
| SMILES | C/N=C(\N)NC(=O)Nc1c(Cl)cccc1Cl.Cl |
| InChI | InChI=1S/C9H10Cl2N4O.ClH/c1-13-8(12)15-9(16)14-7-5(10)3-2-4-6(7)11;/h2-4H,1H3,(H4,12,13,14,15,16);1H |
| InChIKey | WCJPQXSGNBVIPV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride?
The IUPAC name of 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride (CID 3052264) is 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride.
What is the SMILES notation for 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride?
The canonical SMILES for 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride is C/N=C(\N)NC(=O)Nc1c(Cl)cccc1Cl.Cl.
What is the InChIKey of 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride?
The InChIKey is WCJPQXSGNBVIPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2N4O.ClH/c1-13-8(12)15-9(16)14-7-5(10)3-2-4-6(7)11;/h2-4H,1H3,(H4,12,13,14,15,16);1H.
What are the key properties of 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride?
1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride has a molecular weight of 297.57 g/mol, XLogP of 2.48, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dichlorophenyl)-3-(N'-methylcarbamimidoyl)urea;hydrochloride is sourced from PubChem (CID 3052264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).