C47H45N5O9S2 — CID 3052423
1-N-[4-[(1-ethylpyridin-1-ium-3-carbonyl)amino]phenyl]-4-N-(1-ethylquinolin-1-ium-6-yl)benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) (PubChem CID 3052423) has the molecular formula C47H45N5O9S2 and a molecular weight of 888.04 g/mol. Its IUPAC name is 1-N-[4-[(1-ethylpyridin-1-ium-3-carbonyl)amino]phenyl]-4-N-(1-ethylquinolin-1-ium-6-yl)benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate).
| Compound Name | 1-N-[4-[(1-ethylpyridin-1-ium-3-carbonyl)amino]phenyl]-4-N-(1-ethylquinolin-1-ium-6-yl)benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) |
|---|---|
| PubChem CID | 3052423 |
| Molecular Formula | C47H45N5O9S2 |
| Molecular Weight | 888.04 g/mol |
| Exact Mass | 887.27 |
| IUPAC Name | 1-N-[4-[(1-ethylpyridin-1-ium-3-carbonyl)amino]phenyl]-4-N-(1-ethylquinolin-1-ium-6-yl)benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) |
| SMILES | CC[n+]1cccc(C(=O)Nc2ccc(NC(=O)c3ccc(C(=O)Nc4ccc5c(ccc[n+]5CC)c4)cc3)cc2)c1.Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C33H29N5O3.2C7H8O3S/c1-3-37-19-5-8-26(22-37)33(41)35-28-15-13-27(14-16-28)34-31(39)23-9-11-24(12-10-23)32(40)36-29-17-18-30-25(21-29)7-6-20-38(30)4-2;2*1-6-2-4-7(5-3-6)11(8,9)10/h5-22H,3-4H2,1-2H3,(H-2,34,35,36,39,40,41);2*2-5H,1H3,(H,8,9,10) |
| InChIKey | XYUOHBNTMLENOQ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 209.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.04 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|