C51H53N5O9S2 — CID 3052425
1-N-[4-[(1-butylpyridin-1-ium-3-carbonyl)amino]phenyl]-4-N-(1-butylquinolin-1-ium-6-yl)benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) (PubChem CID 3052425) has the molecular formula C51H53N5O9S2 and a molecular weight of 944.14 g/mol. Its IUPAC name is 1-N-[4-[(1-butylpyridin-1-ium-3-carbonyl)amino]phenyl]-4-N-(1-butylquinolin-1-ium-6-yl)benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate).
| Compound Name | 1-N-[4-[(1-butylpyridin-1-ium-3-carbonyl)amino]phenyl]-4-N-(1-butylquinolin-1-ium-6-yl)benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) |
|---|---|
| PubChem CID | 3052425 |
| Molecular Formula | C51H53N5O9S2 |
| Molecular Weight | 944.14 g/mol |
| Exact Mass | 943.33 |
| IUPAC Name | 1-N-[4-[(1-butylpyridin-1-ium-3-carbonyl)amino]phenyl]-4-N-(1-butylquinolin-1-ium-6-yl)benzene-1,4-dicarboxamide;bis(4-methylbenzenesulfonate) |
| SMILES | CCCC[n+]1cccc(C(=O)Nc2ccc(NC(=O)c3ccc(C(=O)Nc4ccc5c(ccc[n+]5CCCC)c4)cc3)cc2)c1.Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C37H37N5O3.2C7H8O3S/c1-3-5-21-41-22-7-10-30(26-41)37(45)39-32-17-15-31(16-18-32)38-35(43)27-11-13-28(14-12-27)36(44)40-33-19-20-34-29(25-33)9-8-24-42(34)23-6-4-2;2*1-6-2-4-7(5-3-6)11(8,9)10/h7-20,22,24-26H,3-6,21,23H2,1-2H3,(H-2,38,39,40,43,44,45);2*2-5H,1H3,(H,8,9,10) |
| InChIKey | OPBBZXKIFSKFNC-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 209.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.14 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|