C15H21NO — CID 3052514
1-(3,4-dihydro-2H-quinolin-1-yl)-2-methylpentan-1-one (PubChem CID 3052514) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-2-methylpentan-1-one.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-methylpentan-1-one |
|---|---|
| PubChem CID | 3052514 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-methylpentan-1-one |
| SMILES | CCCC(C)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C15H21NO/c1-3-7-12(2)15(17)16-11-6-9-13-8-4-5-10-14(13)16/h4-5,8,10,12H,3,6-7,9,11H2,1-2H3 |
| InChIKey | XCSNHDQPYFGISL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |