About 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide
2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide (PubChem CID 3052614) has the molecular formula C10H14BrNO2
and a molecular weight of 260.13 g/mol. Its IUPAC name is 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide.
Molecular Properties
| Compound Name | 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide |
| PubChem CID | 3052614 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide |
| SMILES | CC(=O)OCC[n+]1ccc(C)cc1.[Br-] |
| InChI | InChI=1S/C10H14NO2.BrH/c1-9-3-5-11(6-4-9)7-8-13-10(2)12;/h3-6H,7-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | CHDUVOGEJNXMFQ-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide?
The IUPAC name of 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide (CID 3052614) is 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide.
What is the SMILES notation for 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide?
The canonical SMILES for 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide is CC(=O)OCC[n+]1ccc(C)cc1.[Br-].
What is the InChIKey of 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide?
The InChIKey is CHDUVOGEJNXMFQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H14NO2.BrH/c1-9-3-5-11(6-4-9)7-8-13-10(2)12;/h3-6H,7-8H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide?
2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide has a molecular weight of 260.13 g/mol, XLogP of -2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylpyridin-1-ium-1-yl)ethyl acetate bromide is sourced from PubChem (CID 3052614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).