C31H47Br2N4O2P — CID 30527
benzyl-[3-[[[3-[benzyl(dimethyl)azaniumyl]propylamino]-(4-methylphenoxy)phosphoryl]amino]propyl]-dimethylazanium dibromide (PubChem CID 30527) has the molecular formula C31H47Br2N4O2P and a molecular weight of 698.53 g/mol. Its IUPAC name is benzyl-[3-[[[3-[benzyl(dimethyl)azaniumyl]propylamino]-(4-methylphenoxy)phosphoryl]amino]propyl]-dimethylazanium dibromide.
| Compound Name | benzyl-[3-[[[3-[benzyl(dimethyl)azaniumyl]propylamino]-(4-methylphenoxy)phosphoryl]amino]propyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 30527 |
| Molecular Formula | C31H47Br2N4O2P |
| Molecular Weight | 698.53 g/mol |
| Exact Mass | 696.18 |
| IUPAC Name | benzyl-[3-[[[3-[benzyl(dimethyl)azaniumyl]propylamino]-(4-methylphenoxy)phosphoryl]amino]propyl]-dimethylazanium dibromide |
| SMILES | Cc1ccc(OP(=O)(NCCC[N+](C)(C)Cc2ccccc2)NCCC[N+](C)(C)Cc2ccccc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C31H47N4O2P.2BrH/c1-28-18-20-31(21-19-28)37-38(36,32-22-12-24-34(2,3)26-29-14-8-6-9-15-29)33-23-13-25-35(4,5)27-30-16-10-7-11-17-30;;/h6-11,14-21H,12-13,22-27H2,1-5H3,(H2,32,33,36);2*1H/q+2;;/p-2 |
| InChIKey | SJRCRJHWTFRAMR-UHFFFAOYSA-L |
| XLogP | 0.00 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.53 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|