C15H15NO2 — CID 3052782
4,6,8,9-tetramethyl-1H-furo[2,3-h]quinolin-2-one (PubChem CID 3052782) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4,6,8,9-tetramethyl-1H-furo[2,3-h]quinolin-2-one.
| Compound Name | 4,6,8,9-tetramethyl-1H-furo[2,3-h]quinolin-2-one |
|---|---|
| PubChem CID | 3052782 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4,6,8,9-tetramethyl-1H-furo[2,3-h]quinolin-2-one |
| SMILES | Cc1oc2c(C)cc3c(C)cc(=O)[nH]c3c2c1C |
| InChI | InChI=1S/C15H15NO2/c1-7-6-12(17)16-14-11(7)5-8(2)15-13(14)9(3)10(4)18-15/h5-6H,1-4H3,(H,16,17) |
| InChIKey | ZFHPBRXQLCICCO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |