About 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide
2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide (PubChem CID 3052880) has the molecular formula C17H20BrN
and a molecular weight of 318.26 g/mol. Its IUPAC name is 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide.
Molecular Properties
| Compound Name | 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide |
| PubChem CID | 3052880 |
| Molecular Formula | C17H20BrN |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide |
| SMILES | Br.CC1Cc2cccc(-c3ccccc3)c2CN1C |
| InChI | InChI=1S/C17H19N.BrH/c1-13-11-15-9-6-10-16(17(15)12-18(13)2)14-7-4-3-5-8-14;/h3-10,13H,11-12H2,1-2H3;1H |
| InChIKey | SOGREIDAKJLDPI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide?
The IUPAC name of 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide (CID 3052880) is 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide.
What is the SMILES notation for 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide?
The canonical SMILES for 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide is Br.CC1Cc2cccc(-c3ccccc3)c2CN1C.
What is the InChIKey of 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide?
The InChIKey is SOGREIDAKJLDPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N.BrH/c1-13-11-15-9-6-10-16(17(15)12-18(13)2)14-7-4-3-5-8-14;/h3-10,13H,11-12H2,1-2H3;1H.
What are the key properties of 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide?
2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide has a molecular weight of 318.26 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrobromide is sourced from PubChem (CID 3052880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).