About 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine
1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine (PubChem CID 3053019) has the molecular formula C10H11N5
and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine.
Molecular Properties
| Compound Name | 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine |
| PubChem CID | 3053019 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine |
| SMILES | CNNc1nncc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H11N5/c1-11-14-10-13-9(7-12-15-10)8-5-3-2-4-6-8/h2-7,11H,1H3,(H,13,14,15) |
| InChIKey | VRMBXAUHRGOOOK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine?
The IUPAC name of 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine (CID 3053019) is 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine.
What is the SMILES notation for 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine?
The canonical SMILES for 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine is CNNc1nncc(-c2ccccc2)n1.
What is the InChIKey of 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine?
The InChIKey is VRMBXAUHRGOOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5/c1-11-14-10-13-9(7-12-15-10)8-5-3-2-4-6-8/h2-7,11H,1H3,(H,13,14,15).
What are the key properties of 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine?
1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine has a molecular weight of 201.23 g/mol, XLogP of 1.08, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(5-phenyl-1,2,4-triazin-3-yl)hydrazine is sourced from PubChem (CID 3053019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).