C20H23N5O3 — CID 30530459
N-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2H-benzotriazole-5-carboxamide (PubChem CID 30530459) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 30530459 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2H-benzotriazole-5-carboxamide |
| SMILES | COc1ccc([C@H](CNC(=O)c2ccc3n[nH]nc3c2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23N5O3/c1-27-16-5-2-14(3-6-16)19(25-8-10-28-11-9-25)13-21-20(26)15-4-7-17-18(12-15)23-24-22-17/h2-7,12,19H,8-11,13H2,1H3,(H,21,26)(H,22,23,24)/t19-/m0/s1 |
| InChIKey | SWQBUUIVDNVISK-IBGZPJMESA-N |
| XLogP | 1.77 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |