About [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine
[5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine (PubChem CID 3053054) has the molecular formula C10H8F3N5
and a molecular weight of 255.20 g/mol. Its IUPAC name is [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine.
Molecular Properties
| Compound Name | [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine |
| PubChem CID | 3053054 |
| Molecular Formula | C10H8F3N5 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine |
| SMILES | NNc1nncc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C10H8F3N5/c11-10(12,13)7-3-1-2-6(4-7)8-5-15-18-9(16-8)17-14/h1-5H,14H2,(H,16,17,18) |
| InChIKey | KDEAMNZLDHHLDO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine?
The IUPAC name of [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine (CID 3053054) is [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine.
What is the SMILES notation for [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine?
The canonical SMILES for [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine is NNc1nncc(-c2cccc(C(F)(F)F)c2)n1.
What is the InChIKey of [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine?
The InChIKey is KDEAMNZLDHHLDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N5/c11-10(12,13)7-3-1-2-6(4-7)8-5-15-18-9(16-8)17-14/h1-5H,14H2,(H,16,17,18).
What are the key properties of [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine?
[5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine has a molecular weight of 255.20 g/mol, XLogP of 1.84, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[3-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]hydrazine is sourced from PubChem (CID 3053054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).