About [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate
[1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate (PubChem CID 3053118) has the molecular formula C17H25NO4
and a molecular weight of 307.39 g/mol. Its IUPAC name is [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate.
Molecular Properties
| Compound Name | [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate |
| PubChem CID | 3053118 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate |
| SMILES | CCC(=O)OC1(c2ccccc2)CCN(CC(O)CO)C1C |
| InChI | InChI=1S/C17H25NO4/c1-3-16(21)22-17(14-7-5-4-6-8-14)9-10-18(13(17)2)11-15(20)12-19/h4-8,13,15,19-20H,3,9-12H2,1-2H3 |
| InChIKey | PSFHWPACFHCLSV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate?
The IUPAC name of [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate (CID 3053118) is [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate.
What is the SMILES notation for [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate?
The canonical SMILES for [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate is CCC(=O)OC1(c2ccccc2)CCN(CC(O)CO)C1C.
What is the InChIKey of [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate?
The InChIKey is PSFHWPACFHCLSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4/c1-3-16(21)22-17(14-7-5-4-6-8-14)9-10-18(13(17)2)11-15(20)12-19/h4-8,13,15,19-20H,3,9-12H2,1-2H3.
What are the key properties of [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate?
[1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate has a molecular weight of 307.39 g/mol, XLogP of 1.28, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydroxypropyl)-2-methyl-3-phenylpyrrolidin-3-yl] propanoate is sourced from PubChem (CID 3053118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).