About 4-decylsulfanyl-1,1-dioxothiolan-3-ol
4-decylsulfanyl-1,1-dioxothiolan-3-ol (PubChem CID 3053239) has the molecular formula C14H28O3S2
and a molecular weight of 308.51 g/mol. Its IUPAC name is 4-decylsulfanyl-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-decylsulfanyl-1,1-dioxothiolan-3-ol |
| PubChem CID | 3053239 |
| Molecular Formula | C14H28O3S2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-decylsulfanyl-1,1-dioxothiolan-3-ol |
| SMILES | CCCCCCCCCCSC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C14H28O3S2/c1-2-3-4-5-6-7-8-9-10-18-14-12-19(16,17)11-13(14)15/h13-15H,2-12H2,1H3 |
| InChIKey | PATSQZYUYMUHQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-decylsulfanyl-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-decylsulfanyl-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-decylsulfanyl-1,1-dioxothiolan-3-ol (CID 3053239) is 4-decylsulfanyl-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-decylsulfanyl-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-decylsulfanyl-1,1-dioxothiolan-3-ol is CCCCCCCCCCSC1CS(=O)(=O)CC1O.
What is the InChIKey of 4-decylsulfanyl-1,1-dioxothiolan-3-ol?
The InChIKey is PATSQZYUYMUHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3S2/c1-2-3-4-5-6-7-8-9-10-18-14-12-19(16,17)11-13(14)15/h13-15H,2-12H2,1H3.
What are the key properties of 4-decylsulfanyl-1,1-dioxothiolan-3-ol?
4-decylsulfanyl-1,1-dioxothiolan-3-ol has a molecular weight of 308.51 g/mol, XLogP of 3.02, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-decylsulfanyl-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 3053239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).